Product Information
| Catalog Num | A12781 |
|---|---|
| Formula | C27H36N4O5S.CH4O3S |
| Molecular Weight | 624.77 |
| CAS Number | 159752-10-0 |
| SMILES | CC(C)(C(=O)N[C@H](COCC1=CC=CC=C1)C(=O)N2CCC3(CC2)CN(C4=CC=CC=C34)S(=O)(=O)C)N.CS(=O)(=O)O |
| Synonyms | MK677, MK 677 |
| Storage |
Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 92 mg/mL (147.25 mM) | |
| Water | 92 mg/mL (147.25 mM) | ||
| Ethanol | 92 mg/mL (147.25 mM) | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 16.01 mL | 80.03 mL | 160.06 mL |
| 0.5 mM | 3.2 mL | 16.01 mL | 32.01 mL |
| 1 mM | 1.6 mL | 8 mL | 16.01 mL |
| 5 mM | 0.32 mL | 1.6 mL | 3.2 mL |